Description
A 7-methylguanine that is 7H-purine substituted by an amino group at position 2, a methyl group at position 7 and a hydroxy group at position 6.
Chemical properties
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C6H7N5O | 0 | 165.153 |
Recommended notation
| Name | 2-amino-7-methyl-7H-purin-6-ol |
|---|---|
| Abbreviation | 7mG |
Nomenclature
| IUPAC | SMILES | InChI | InChIKey |
|---|---|---|---|
| 2-amino-7-methyl-7H-purin-6-ol | C=12C(=NC(=NC1O)N)N=CN2C | InChI=1S/C6H7N5O/c1-11-2-8-4-3(11)5(12)10-6(7)9-4/h2H,1H3,(H3,7,9,10,12) | FZWGECJQACGGTI-UHFFFAOYSA-N |