A purine 2'-deoxyribonucleoside that is inosine in which the hydroxy group at position 2' is replaced by a hydrogen.
Chemical formula | Net charge | Average mass |
---|---|---|
C10H12N4O4 | 0 | 252.22684 |
Name | 2'-deoxyinosine |
---|---|
Abbreviation | dI |
IUPAC | SMILES | InChI | InChIKey | Synonyms |
---|---|---|---|---|
2'-deoxyinosine, 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-9H-purin-6-ol | OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c1nc[nH]c2=O | InChI=1S/C10H12N4O4/c15-2-6-5(16)1-7(18-6)14-4-13-8-9(14)11-3-12-10(8)17/h3-7,15-16H,1-2H2,(H,11,12,17)/t5-,6+,7+/m0/s1 | VGONTNSXDCQUGY-RRKCRQDMSA-N |
|
Origin | Function | Functional detail |
Organisms
|
References |
---|---|---|---|---|
natural | damage and hypermodified nucleobase |
|
|