Description
Pyrimidine substituted with a methoxy group at position C-2 and an amine group at C-4.
Chemical properties
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C5H7N3O | 0 | 125.12860 |
Recommended notation
| Name | 2-O-methylcytosine |
|---|---|
| Abbreviation | m2C |
Nomenclature
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 2-methoxypyrimidin-4-amine | COc1nccc(N)n1 | InChI=1S/C5H7N3O/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3,(H2,6,7,8) | DHYLZDVDOQLEAQ-UHFFFAOYSA-N |
|
Citations
- Roux, A, et al. 2012. Annotation of the human adult urinary metabolome and metabolite identification using ultra high performance liquid chromatography coupled to a linear quadrupole ion trap-Orbitrap mass spectrometer. Analytical Chemistry. 84(15).