A 3-methylguanine that is 3,9-dihydro-6H-purin-6-one substituted by an amino group at position 2 and a methyl group at position 3.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C6H7N5O | 0 | 165.153 |
| Name | 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one |
|---|---|
| Abbreviation | 3mG |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 2-amino-3-methyl-3,9-dihydro-6H-purin-6-one | Cn1c(N)nc(=O)c2nc[nH]c12 | InChI=1S/C6H7N5O/c1-11-4-3(8-2-9-4)5(12)10-6(11)7/h2H,1H3,(H,8,9)(H2,7,10,12) | XHBSBNYEHDQRCP-UHFFFAOYSA-N |
|