A pyrimidine 2'-deoxyribonucleoside that is 2'-deoxyuridine in which the hydrogen at position 5 has been replaced by a 2-aminoethyl group. It is a thymidine hypermodification replacing 30% of thymidine in the DNA of the Pseudomonas phage M6.
Chemical formula | Net charge | Average mass |
---|---|---|
C11H17N3O5 | 0 | 271.270 |
Name | 5-(2-aminoethyl)uridine |
---|---|
Abbreviation | 5-NedU |
IUPAC | SMILES | InChI | InChIKey | Synonyms |
---|---|---|---|---|
5-(2-aminoethyl)-2'-deoxyuridine | N1(C(NC(C(=C1)CCN)=O)=O)[C@H]2C[C@@H]([C@H](O2)CO)O | InChI=1S/C11H17N3O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h4,7-9,15-16H,1-3,5,12H2,(H,13,17,18)/t7-,8+,9+/m0/s1 | WTDDCUXJNCBBKI-DJLDLDEBSA-N |
|
Origin | Function | Functional detail |
Organisms
|
References |
---|---|---|---|---|
natural | hypermodified nucleobase | bacteriophage M6 |
|