Description
Adenine substituted with a methyl group at position N-9.
Chemical properties
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C6H7N5 | 0 | 149.15330 |
Recommended notation
| Name | 9-methyladenine |
|---|---|
| Abbreviation | 9mA |
Nomenclature
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 9-methyl-9H-purin-6-amine | Cn1cnc2c(N)ncnc12 | InChI=1S/C6H7N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h2-3H,1H3,(H2,7,8,9) | WRXCXOUDSPTXNX-UHFFFAOYSA-N |
|
Citations
- Roux, A, et al. 2012. Annotation of the human adult urinary metabolome and metabolite identification using ultra high performance liquid chromatography coupled to a linear quadrupole ion trap-Orbitrap mass spectrometer. Analytical Chemistry. 84(15).