An oxopurine that is guanine substituted by a (2-hydroxyethoxy)methyl substituent at position 9. Used in the treatment of viral infections.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C8H11N5O3 | 0 | 225.20460 |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 2-amino-9-[(2-hydroxyethoxy)methyl]-1,9-dihydro-6H-purin-6-one | Nc1nc2n(COCCO)cnc2c(=O)[nH]1 | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) | MKUXAQIIEYXACX-UHFFFAOYSA-N |
|